About N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine
N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 808782) has the molecular formula C23H23N3
and a molecular weight of 341.46 g/mol. Its IUPAC name is N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 808782 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cc(C)n2c(NCc3ccccc3)c(-c3ccccc3C)nc2c1 |
| InChI | InChI=1S/C23H23N3/c1-16-13-18(3)26-21(14-16)25-22(20-12-8-7-9-17(20)2)23(26)24-15-19-10-5-4-6-11-19/h4-14,24H,15H2,1-3H3 |
| InChIKey | VKMGSDUJZDHZCQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine (CID 808782) is N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine is Cc1cc(C)n2c(NCc3ccccc3)c(-c3ccccc3C)nc2c1.
What is the InChIKey of N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is VKMGSDUJZDHZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3/c1-16-13-18(3)26-21(14-16)25-22(20-12-8-7-9-17(20)2)23(26)24-15-19-10-5-4-6-11-19/h4-14,24H,15H2,1-3H3.
What are the key properties of N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine?
N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 341.46 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5,7-dimethyl-2-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 808782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).