C10H12F5N3O — CID 80878225
N,2,5-trimethyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidin-4-amine (PubChem CID 80878225) has the molecular formula C10H12F5N3O and a molecular weight of 285.22 g/mol. Its IUPAC name is N,2,5-trimethyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidin-4-amine.
| Compound Name | N,2,5-trimethyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80878225 |
| Molecular Formula | C10H12F5N3O |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N,2,5-trimethyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc(OCC(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C10H12F5N3O/c1-5-7(16-3)17-6(2)18-8(5)19-4-9(11,12)10(13,14)15/h4H2,1-3H3,(H,16,17,18) |
| InChIKey | BGRMZLVPDGEMLH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|