C16H21N3OS — CID 80879508
5-ethyl-6-(4-methylsulfanylphenoxy)-N-propylpyrimidin-4-amine (PubChem CID 80879508) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 5-ethyl-6-(4-methylsulfanylphenoxy)-N-propylpyrimidin-4-amine.
| Compound Name | 5-ethyl-6-(4-methylsulfanylphenoxy)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80879508 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-ethyl-6-(4-methylsulfanylphenoxy)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(Oc2ccc(SC)cc2)c1CC |
| InChI | InChI=1S/C16H21N3OS/c1-4-10-17-15-14(5-2)16(19-11-18-15)20-12-6-8-13(21-3)9-7-12/h6-9,11H,4-5,10H2,1-3H3,(H,17,18,19) |
| InChIKey | PDPAXHLLTWPNDV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |