C10H8F2N4O2 — CID 80879795
4-(2,3-difluorophenoxy)-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 80879795) has the molecular formula C10H8F2N4O2 and a molecular weight of 254.20 g/mol. Its IUPAC name is 4-(2,3-difluorophenoxy)-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3-difluorophenoxy)-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80879795 |
| Molecular Formula | C10H8F2N4O2 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-(2,3-difluorophenoxy)-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(Oc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C10H8F2N4O2/c1-17-9-14-8(13)15-10(16-9)18-6-4-2-3-5(11)7(6)12/h2-4H,1H3,(H2,13,14,15,16) |
| InChIKey | OJZKOSWRNHRUCE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |