2-(carboxymethoxy)acetic acid

C4H6O5 — CID 8088

IUPAC2-(carboxymethoxy)acetic acid
SMILESO=C(O)COCC(=O)O
InChIInChI=1S/C4H6O5/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)
InChIKeyQEVGZEDELICMKH-UHFFFAOYSA-N
MW134.09 g/mol
LogP-0.83
Rot. Bonds4

About 2-(carboxymethoxy)acetic acid

2-(carboxymethoxy)acetic acid (PubChem CID 8088) has the molecular formula C4H6O5 and a molecular weight of 134.09 g/mol. Its IUPAC name is 2-(carboxymethoxy)acetic acid.

Molecular Properties

Compound Name2-(carboxymethoxy)acetic acid
PubChem CID8088
Molecular FormulaC4H6O5
Molecular Weight134.09 g/mol
Exact Mass134.02
IUPAC Name2-(carboxymethoxy)acetic acid
SMILESO=C(O)COCC(=O)O
InChIInChI=1S/C4H6O5/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)
InChIKeyQEVGZEDELICMKH-UHFFFAOYSA-N
XLogP-0.83
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.09
LogP ≤ 5-0.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(carboxymethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(carboxymethoxy)acetic acid?
The IUPAC name of 2-(carboxymethoxy)acetic acid (CID 8088) is 2-(carboxymethoxy)acetic acid.
What is the SMILES notation for 2-(carboxymethoxy)acetic acid?
The canonical SMILES for 2-(carboxymethoxy)acetic acid is O=C(O)COCC(=O)O.
What is the InChIKey of 2-(carboxymethoxy)acetic acid?
The InChIKey is QEVGZEDELICMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8).
What are the key properties of 2-(carboxymethoxy)acetic acid?
2-(carboxymethoxy)acetic acid has a molecular weight of 134.09 g/mol, XLogP of -0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carboxymethoxy)acetic acid is sourced from PubChem (CID 8088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).