C14H12F2N2O3 — CID 80880134
3-(3,5-difluorophenoxy)-N-ethyl-5-nitroaniline (PubChem CID 80880134) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is 3-(3,5-difluorophenoxy)-N-ethyl-5-nitroaniline.
| Compound Name | 3-(3,5-difluorophenoxy)-N-ethyl-5-nitroaniline |
|---|---|
| PubChem CID | 80880134 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-(3,5-difluorophenoxy)-N-ethyl-5-nitroaniline |
| SMILES | CCNc1cc(Oc2cc(F)cc(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12F2N2O3/c1-2-17-11-6-12(18(19)20)8-14(7-11)21-13-4-9(15)3-10(16)5-13/h3-8,17H,2H2,1H3 |
| InChIKey | KMBPUPGKYKYGHM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|