About 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine
6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine (PubChem CID 80880795) has the molecular formula C10H8F2N4O
and a molecular weight of 238.20 g/mol. Its IUPAC name is 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine |
| PubChem CID | 80880795 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Oc2cc(F)cc(F)c2)nc(N)n1 |
| InChI | InChI=1S/C10H8F2N4O/c11-5-1-6(12)3-7(2-5)17-9-4-8(13)15-10(14)16-9/h1-4H,(H4,13,14,15,16) |
| InChIKey | PUQZWBVXBWMUME-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine?
The IUPAC name of 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine (CID 80880795) is 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine?
The canonical SMILES for 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine is Nc1cc(Oc2cc(F)cc(F)c2)nc(N)n1.
What is the InChIKey of 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine?
The InChIKey is PUQZWBVXBWMUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O/c11-5-1-6(12)3-7(2-5)17-9-4-8(13)15-10(14)16-9/h1-4H,(H4,13,14,15,16).
What are the key properties of 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine?
6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine has a molecular weight of 238.20 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenoxy)pyrimidine-2,4-diamine is sourced from PubChem (CID 80880795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).