C15H19N3O — CID 80881852
N-ethyl-6-(2,3,5-trimethylphenoxy)pyrazin-2-amine (PubChem CID 80881852) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-ethyl-6-(2,3,5-trimethylphenoxy)pyrazin-2-amine.
| Compound Name | N-ethyl-6-(2,3,5-trimethylphenoxy)pyrazin-2-amine |
|---|---|
| PubChem CID | 80881852 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-ethyl-6-(2,3,5-trimethylphenoxy)pyrazin-2-amine |
| SMILES | CCNc1cncc(Oc2cc(C)cc(C)c2C)n1 |
| InChI | InChI=1S/C15H19N3O/c1-5-17-14-8-16-9-15(18-14)19-13-7-10(2)6-11(3)12(13)4/h6-9H,5H2,1-4H3,(H,17,18) |
| InChIKey | BPIKFNMQRJNWOF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |