C12H15ClN6S — CID 80882452
5-chloro-N-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80882452) has the molecular formula C12H15ClN6S and a molecular weight of 310.81 g/mol. Its IUPAC name is 5-chloro-N-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80882452 |
| Molecular Formula | C12H15ClN6S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-chloro-N-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine |
| SMILES | CNc1ncc(Cl)c(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C12H15ClN6S/c1-14-11-15-7-8(13)10(16-11)20-12-18-17-9-5-3-2-4-6-19(9)12/h7H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | HEAJNULYLHQVIP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |