C12H16N6S — CID 80882789
N-methyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine (PubChem CID 80882789) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is N-methyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine.
| Compound Name | N-methyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80882789 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-methyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine |
| SMILES | CNc1cncc(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C12H16N6S/c1-13-9-7-14-8-11(15-9)19-12-17-16-10-5-3-2-4-6-18(10)12/h7-8H,2-6H2,1H3,(H,13,15) |
| InChIKey | JYFIJHHXUWNBAN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |