C10H15N7S — CID 80884142
4-butylsulfanyl-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80884142) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-butylsulfanyl-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-butylsulfanyl-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80884142 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-butylsulfanyl-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCSc1nc(NC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H15N7S/c1-3-4-5-18-10-15-8(11-2)14-9(16-10)17-7-12-6-13-17/h6-7H,3-5H2,1-2H3,(H,11,14,15,16) |
| InChIKey | PCWSRZJMWYZPLQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|