C10H11N5O2S — CID 80884589
N-ethyl-2-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)aniline (PubChem CID 80884589) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is N-ethyl-2-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)aniline.
| Compound Name | N-ethyl-2-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 80884589 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-ethyl-2-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)aniline |
| SMILES | CCNc1cccc(Sc2ncn[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O2S/c1-2-11-7-4-3-5-8(9(7)15(16)17)18-10-12-6-13-14-10/h3-6,11H,2H2,1H3,(H,12,13,14) |
| InChIKey | BTUHKLXJASHBEF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|