C12H11F2N3S — CID 80884884
6-(2,5-difluorophenyl)sulfanyl-5-ethylpyrimidin-4-amine (PubChem CID 80884884) has the molecular formula C12H11F2N3S and a molecular weight of 267.30 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)sulfanyl-5-ethylpyrimidin-4-amine.
| Compound Name | 6-(2,5-difluorophenyl)sulfanyl-5-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80884884 |
| Molecular Formula | C12H11F2N3S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-(2,5-difluorophenyl)sulfanyl-5-ethylpyrimidin-4-amine |
| SMILES | CCc1c(N)ncnc1Sc1cc(F)ccc1F |
| InChI | InChI=1S/C12H11F2N3S/c1-2-8-11(15)16-6-17-12(8)18-10-5-7(13)3-4-9(10)14/h3-6H,2H2,1H3,(H2,15,16,17) |
| InChIKey | RBKJRMASVWUOLR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |