About 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine
5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80885174) has the molecular formula C6H5FN6S
and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine |
| PubChem CID | 80885174 |
| Molecular Formula | C6H5FN6S |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Sc2ncn[nH]2)n1 |
| InChI | InChI=1S/C6H5FN6S/c7-3-1-9-5(8)12-4(3)14-6-10-2-11-13-6/h1-2H,(H2,8,9,12)(H,10,11,13) |
| InChIKey | SNBTWWYDIQOXKN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine?
The IUPAC name of 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine (CID 80885174) is 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine?
The canonical SMILES for 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine is Nc1ncc(F)c(Sc2ncn[nH]2)n1.
What is the InChIKey of 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine?
The InChIKey is SNBTWWYDIQOXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN6S/c7-3-1-9-5(8)12-4(3)14-6-10-2-11-13-6/h1-2H,(H2,8,9,12)(H,10,11,13).
What are the key properties of 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine?
5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine has a molecular weight of 212.21 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-2-amine is sourced from PubChem (CID 80885174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).