C11H11N3O2S2 — CID 80885391
N-ethyl-3-nitro-5-(1,3-thiazol-2-ylsulfanyl)aniline (PubChem CID 80885391) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-ethyl-3-nitro-5-(1,3-thiazol-2-ylsulfanyl)aniline.
| Compound Name | N-ethyl-3-nitro-5-(1,3-thiazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 80885391 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-ethyl-3-nitro-5-(1,3-thiazol-2-ylsulfanyl)aniline |
| SMILES | CCNc1cc(Sc2nccs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-2-12-8-5-9(14(15)16)7-10(6-8)18-11-13-3-4-17-11/h3-7,12H,2H2,1H3 |
| InChIKey | YECLOWQNYFRXTR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|