C11H11N5S2 — CID 80886588
N-ethyl-8-(1,3-thiazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80886588) has the molecular formula C11H11N5S2 and a molecular weight of 277.38 g/mol. Its IUPAC name is N-ethyl-8-(1,3-thiazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-ethyl-8-(1,3-thiazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80886588 |
| Molecular Formula | C11H11N5S2 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-ethyl-8-(1,3-thiazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCNc1cn2ccnc2c(Sc2nccs2)n1 |
| InChI | InChI=1S/C11H11N5S2/c1-2-12-8-7-16-5-3-13-9(16)10(15-8)18-11-14-4-6-17-11/h3-7,12H,2H2,1H3 |
| InChIKey | PCKRXBMMWFGOLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|