About 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine
5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (PubChem CID 80886994) has the molecular formula C14H18FN5S
and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| PubChem CID | 80886994 |
| Molecular Formula | C14H18FN5S |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(Sc2nc(C)c(C)c(C)n2)n1 |
| InChI | InChI=1S/C14H18FN5S/c1-5-6-16-13-17-7-11(15)12(20-13)21-14-18-9(3)8(2)10(4)19-14/h7H,5-6H2,1-4H3,(H,16,17,20) |
| InChIKey | MEFCRYCBSJLBRK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The IUPAC name of 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (CID 80886994) is 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The canonical SMILES for 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is CCCNc1ncc(F)c(Sc2nc(C)c(C)c(C)n2)n1.
What is the InChIKey of 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The InChIKey is MEFCRYCBSJLBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN5S/c1-5-6-16-13-17-7-11(15)12(20-13)21-14-18-9(3)8(2)10(4)19-14/h7H,5-6H2,1-4H3,(H,16,17,20).
What are the key properties of 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine has a molecular weight of 307.40 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-propyl-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is sourced from PubChem (CID 80886994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).