C10H12N4OS2 — CID 80887884
4-propoxy-6-thiophen-2-ylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 80887884) has the molecular formula C10H12N4OS2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 4-propoxy-6-thiophen-2-ylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-propoxy-6-thiophen-2-ylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80887884 |
| Molecular Formula | C10H12N4OS2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-propoxy-6-thiophen-2-ylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(N)nc(Sc2cccs2)n1 |
| InChI | InChI=1S/C10H12N4OS2/c1-2-5-15-9-12-8(11)13-10(14-9)17-7-4-3-6-16-7/h3-4,6H,2,5H2,1H3,(H2,11,12,13,14) |
| InChIKey | MRLONTAKOXYYHZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |