About 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine
5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (PubChem CID 80890438) has the molecular formula C11H12FN5S
and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| PubChem CID | 80890438 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1nc(Sc2nc(N)ncc2F)nc(C)c1C |
| InChI | InChI=1S/C11H12FN5S/c1-5-6(2)15-11(16-7(5)3)18-9-8(12)4-14-10(13)17-9/h4H,1-3H3,(H2,13,14,17) |
| InChIKey | IBEKBWXXFUSUHK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The IUPAC name of 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (CID 80890438) is 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The canonical SMILES for 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is Cc1nc(Sc2nc(N)ncc2F)nc(C)c1C.
What is the InChIKey of 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The InChIKey is IBEKBWXXFUSUHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN5S/c1-5-6(2)15-11(16-7(5)3)18-9-8(12)4-14-10(13)17-9/h4H,1-3H3,(H2,13,14,17).
What are the key properties of 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine has a molecular weight of 265.32 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is sourced from PubChem (CID 80890438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).