About N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine
N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (PubChem CID 80890784) has the molecular formula C13H16FN5S
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| PubChem CID | 80890784 |
| Molecular Formula | C13H16FN5S |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(Sc2nc(C)c(C)c(C)n2)n1 |
| InChI | InChI=1S/C13H16FN5S/c1-5-15-12-16-6-10(14)11(19-12)20-13-17-8(3)7(2)9(4)18-13/h6H,5H2,1-4H3,(H,15,16,19) |
| InChIKey | ZWYCXMIROAYIFX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The IUPAC name of N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (CID 80890784) is N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
What is the SMILES notation for N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The canonical SMILES for N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is CCNc1ncc(F)c(Sc2nc(C)c(C)c(C)n2)n1.
What is the InChIKey of N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
The InChIKey is ZWYCXMIROAYIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN5S/c1-5-15-12-16-6-10(14)11(19-12)20-13-17-8(3)7(2)9(4)18-13/h6H,5H2,1-4H3,(H,15,16,19).
What are the key properties of N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine?
N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine has a molecular weight of 293.37 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-fluoro-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpyrimidin-2-amine is sourced from PubChem (CID 80890784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).