C11H12N4S — CID 80891030
N-ethyl-4-pyridin-4-ylsulfanylpyrimidin-2-amine (PubChem CID 80891030) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is N-ethyl-4-pyridin-4-ylsulfanylpyrimidin-2-amine.
| Compound Name | N-ethyl-4-pyridin-4-ylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80891030 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-ethyl-4-pyridin-4-ylsulfanylpyrimidin-2-amine |
| SMILES | CCNc1nccc(Sc2ccncc2)n1 |
| InChI | InChI=1S/C11H12N4S/c1-2-13-11-14-8-5-10(15-11)16-9-3-6-12-7-4-9/h3-8H,2H2,1H3,(H,13,14,15) |
| InChIKey | PFIMRTSBZXAPHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |