C8H10N6S — CID 80892034
6-(1-methylpyrazol-4-yl)sulfanylpyrimidine-2,4-diamine (PubChem CID 80892034) has the molecular formula C8H10N6S and a molecular weight of 222.28 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)sulfanylpyrimidine-2,4-diamine.
| Compound Name | 6-(1-methylpyrazol-4-yl)sulfanylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80892034 |
| Molecular Formula | C8H10N6S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)sulfanylpyrimidine-2,4-diamine |
| SMILES | Cn1cc(Sc2cc(N)nc(N)n2)cn1 |
| InChI | InChI=1S/C8H10N6S/c1-14-4-5(3-11-14)15-7-2-6(9)12-8(10)13-7/h2-4H,1H3,(H4,9,10,12,13) |
| InChIKey | VQNDJNFQQQQWKB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |