C12H15N3OS — CID 80893880
4-(furan-2-ylmethylsulfanyl)-N-propylpyrimidin-2-amine (PubChem CID 80893880) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfanyl)-N-propylpyrimidin-2-amine.
| Compound Name | 4-(furan-2-ylmethylsulfanyl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80893880 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(furan-2-ylmethylsulfanyl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(SCc2ccco2)n1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-6-13-12-14-7-5-11(15-12)17-9-10-4-3-8-16-10/h3-5,7-8H,2,6,9H2,1H3,(H,13,14,15) |
| InChIKey | LKLMWEVXBPNVQQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |