About 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine
4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80894692) has the molecular formula C7H7N5S2
and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine |
| PubChem CID | 80894692 |
| Molecular Formula | C7H7N5S2 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine |
| SMILES | Cc1cc(Sc2ncns2)nc(N)n1 |
| InChI | InChI=1S/C7H7N5S2/c1-4-2-5(12-6(8)11-4)13-7-9-3-10-14-7/h2-3H,1H3,(H2,8,11,12) |
| InChIKey | HYSKITVNXLRZOU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine?
The IUPAC name of 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine (CID 80894692) is 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine.
What is the SMILES notation for 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine?
The canonical SMILES for 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine is Cc1cc(Sc2ncns2)nc(N)n1.
What is the InChIKey of 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine?
The InChIKey is HYSKITVNXLRZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5S2/c1-4-2-5(12-6(8)11-4)13-7-9-3-10-14-7/h2-3H,1H3,(H2,8,11,12).
What are the key properties of 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine?
4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine has a molecular weight of 225.30 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-2-amine is sourced from PubChem (CID 80894692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).