C10H14N2O4S — CID 80895510
3-[3-(methylamino)-5-nitrophenyl]sulfanylpropane-1,2-diol (PubChem CID 80895510) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-[3-(methylamino)-5-nitrophenyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[3-(methylamino)-5-nitrophenyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 80895510 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-[3-(methylamino)-5-nitrophenyl]sulfanylpropane-1,2-diol |
| SMILES | CNc1cc(SCC(O)CO)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N2O4S/c1-11-7-2-8(12(15)16)4-10(3-7)17-6-9(14)5-13/h2-4,9,11,13-14H,5-6H2,1H3 |
| InChIKey | AJMSGIKQDWJSCX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|