C10H8Br2ClN5 — CID 80896859
5-chloro-N-(2,4-dibromophenyl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 80896859) has the molecular formula C10H8Br2ClN5 and a molecular weight of 393.47 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dibromophenyl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-(2,4-dibromophenyl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80896859 |
| Molecular Formula | C10H8Br2ClN5 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 390.88 |
| IUPAC Name | 5-chloro-N-(2,4-dibromophenyl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Cl)c(Nc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C10H8Br2ClN5/c11-5-1-2-8(6(12)3-5)16-9-7(13)4-15-10(17-9)18-14/h1-4H,14H2,(H2,15,16,17,18) |
| InChIKey | LZKHKZYYFGVORC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|