C12H17N5O2 — CID 80898602
2-[(2-hydrazinylquinazolin-4-yl)-(2-hydroxyethyl)amino]ethanol (PubChem CID 80898602) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(2-hydrazinylquinazolin-4-yl)-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[(2-hydrazinylquinazolin-4-yl)-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 80898602 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(2-hydrazinylquinazolin-4-yl)-(2-hydroxyethyl)amino]ethanol |
| SMILES | NNc1nc(N(CCO)CCO)c2ccccc2n1 |
| InChI | InChI=1S/C12H17N5O2/c13-16-12-14-10-4-2-1-3-9(10)11(15-12)17(5-7-18)6-8-19/h1-4,18-19H,5-8,13H2,(H,14,15,16) |
| InChIKey | NVENAVCDOAXSQB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|