C12H15ClN6 — CID 80898733
4-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine (PubChem CID 80898733) has the molecular formula C12H15ClN6 and a molecular weight of 278.75 g/mol. Its IUPAC name is 4-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80898733 |
| Molecular Formula | C12H15ClN6 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CN(Cc1ccccc1Cl)c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C12H15ClN6/c1-19(7-8-4-2-3-5-9(8)13)11-6-10(18-15)16-12(14)17-11/h2-6H,7,15H2,1H3,(H3,14,16,17,18) |
| InChIKey | MVCHRSVVBSWGPC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|