C7H11F3N6 — CID 80898766
6-hydrazinyl-4-N-methyl-4-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine (PubChem CID 80898766) has the molecular formula C7H11F3N6 and a molecular weight of 236.20 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-methyl-4-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-methyl-4-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80898766 |
| Molecular Formula | C7H11F3N6 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 6-hydrazinyl-4-N-methyl-4-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
| SMILES | CN(CC(F)(F)F)c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C7H11F3N6/c1-16(3-7(8,9)10)5-2-4(15-12)13-6(11)14-5/h2H,3,12H2,1H3,(H3,11,13,14,15) |
| InChIKey | KTSDXOVEDXCOFR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|