C9H11F3N4O2 — CID 80899062
3-hydrazinyl-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 80899062) has the molecular formula C9H11F3N4O2 and a molecular weight of 264.21 g/mol. Its IUPAC name is 3-hydrazinyl-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3-hydrazinyl-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 80899062 |
| Molecular Formula | C9H11F3N4O2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-hydrazinyl-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CN(CC(F)(F)F)c1cccc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F3N4O2/c1-15(5-9(10,11)12)7-4-2-3-6(14-13)8(7)16(17)18/h2-4,14H,5,13H2,1H3 |
| InChIKey | LHSJNDZZDLCLKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|