C13H22N6O — CID 80899588
[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80899588) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80899588 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(N2CCCC3CCCCC32)n1 |
| InChI | InChI=1S/C13H22N6O/c1-20-13-16-11(18-14)15-12(17-13)19-8-4-6-9-5-2-3-7-10(9)19/h9-10H,2-8,14H2,1H3,(H,15,16,17,18) |
| InChIKey | BYZVHQGCQKHCEN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|