C14H22N6 — CID 80899759
[6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-5-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80899759) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-5-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-5-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80899759 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | CCc1c(C)nn(-c2ncnc(NN)c2C(C)C)c1C |
| InChI | InChI=1S/C14H22N6/c1-6-11-9(4)19-20(10(11)5)14-12(8(2)3)13(18-15)16-7-17-14/h7-8H,6,15H2,1-5H3,(H,16,17,18) |
| InChIKey | DFQBPAXZPHXJEZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|