C8H11N7 — CID 80900358
[4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine (PubChem CID 80900358) has the molecular formula C8H11N7 and a molecular weight of 205.22 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80900358 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | [4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1nc(C)n(-c2ccnc(NN)n2)n1 |
| InChI | InChI=1S/C8H11N7/c1-5-11-6(2)15(14-5)7-3-4-10-8(12-7)13-9/h3-4H,9H2,1-2H3,(H,10,12,13) |
| InChIKey | ZNQMTSDGKLULBP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|