About [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine
[4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80901290) has the molecular formula C13H15N7O
and a molecular weight of 285.31 g/mol. Its IUPAC name is [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
| PubChem CID | 80901290 |
| Molecular Formula | C13H15N7O |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC(C)Oc1nc(NN)nc(-n2cnc3ccccc32)n1 |
| InChI | InChI=1S/C13H15N7O/c1-8(2)21-13-17-11(19-14)16-12(18-13)20-7-15-9-5-3-4-6-10(9)20/h3-8H,14H2,1-2H3,(H,16,17,18,19) |
| InChIKey | XRPCJKFXMKYCLK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine?
The IUPAC name of [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine (CID 80901290) is [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine.
What is the SMILES notation for [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine?
The canonical SMILES for [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine is CC(C)Oc1nc(NN)nc(-n2cnc3ccccc32)n1.
What is the InChIKey of [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine?
The InChIKey is XRPCJKFXMKYCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N7O/c1-8(2)21-13-17-11(19-14)16-12(18-13)20-7-15-9-5-3-4-6-10(9)20/h3-8H,14H2,1-2H3,(H,16,17,18,19).
What are the key properties of [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine?
[4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine has a molecular weight of 285.31 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzimidazol-1-yl)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine is sourced from PubChem (CID 80901290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).