C9H14F3N5 — CID 80902136
N-ethyl-6-hydrazinyl-2-methyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 80902136) has the molecular formula C9H14F3N5 and a molecular weight of 249.24 g/mol. Its IUPAC name is N-ethyl-6-hydrazinyl-2-methyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-hydrazinyl-2-methyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80902136 |
| Molecular Formula | C9H14F3N5 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-ethyl-6-hydrazinyl-2-methyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CCN(CC(F)(F)F)c1cc(NN)nc(C)n1 |
| InChI | InChI=1S/C9H14F3N5/c1-3-17(5-9(10,11)12)8-4-7(16-13)14-6(2)15-8/h4H,3,5,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PLIQEKYCQJNODS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|