C9H12N8O2 — CID 80902696
1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-N-methylpyrazole-3-carboxamide (PubChem CID 80902696) has the molecular formula C9H12N8O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 80902696 |
| Molecular Formula | C9H12N8O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-N-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1ccn(-c2nc(NN)nc(OC)n2)n1 |
| InChI | InChI=1S/C9H12N8O2/c1-11-6(18)5-3-4-17(16-5)8-12-7(15-10)13-9(14-8)19-2/h3-4H,10H2,1-2H3,(H,11,18)(H,12,13,14,15) |
| InChIKey | KYQCLKJJVIKBEX-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|