C11H19N9O — CID 80902877
4-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 80902877) has the molecular formula C11H19N9O and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80902877 |
| Molecular Formula | C11H19N9O |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1nc(NN)nc(NC(C)c2nncn2C)n1 |
| InChI | InChI=1S/C11H19N9O/c1-6(2)21-11-16-9(15-10(17-11)18-12)14-7(3)8-19-13-5-20(8)4/h5-7H,12H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | UZRWWRGFYWXFSK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|