C9H12ClN7O — CID 80903936
[4-(4-chloro-3-methylpyrazol-1-yl)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80903936) has the molecular formula C9H12ClN7O and a molecular weight of 269.70 g/mol. Its IUPAC name is [4-(4-chloro-3-methylpyrazol-1-yl)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-chloro-3-methylpyrazol-1-yl)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80903936 |
| Molecular Formula | C9H12ClN7O |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [4-(4-chloro-3-methylpyrazol-1-yl)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOc1nc(NN)nc(-n2cc(Cl)c(C)n2)n1 |
| InChI | InChI=1S/C9H12ClN7O/c1-3-18-9-13-7(15-11)12-8(14-9)17-4-6(10)5(2)16-17/h4H,3,11H2,1-2H3,(H,12,13,14,15) |
| InChIKey | GRWSEAIESHMTQF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|