C16H21N5 — CID 80905373
[5-ethyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80905373) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is [5-ethyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5-ethyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80905373 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | [5-ethyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1c(NN)ncnc1N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H21N5/c1-2-14-15(20-17)18-11-19-16(14)21-9-5-8-12-6-3-4-7-13(12)10-21/h3-4,6-7,11H,2,5,8-10,17H2,1H3,(H,18,19,20) |
| InChIKey | WPXJUJQLPPADJJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|