C9H13N9O — CID 80906494
3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propanamide (PubChem CID 80906494) has the molecular formula C9H13N9O and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propanamide.
| Compound Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 80906494 |
| Molecular Formula | C9H13N9O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propanamide |
| SMILES | NNc1nc(NCCC(N)=O)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H13N9O/c10-6(19)1-2-13-7-14-8(17-11)16-9(15-7)18-4-3-12-5-18/h3-5H,1-2,11H2,(H2,10,19)(H2,13,14,15,16,17) |
| InChIKey | JLGGERLAFDWGBK-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 149.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|