C12H19N9 — CID 80906636
N-(1-cyclopentylethyl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80906636) has the molecular formula C12H19N9 and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(1-cyclopentylethyl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80906636 |
| Molecular Formula | C12H19N9 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(1-cyclopentylethyl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CC(Nc1nc(NN)nc(-n2cncn2)n1)C1CCCC1 |
| InChI | InChI=1S/C12H19N9/c1-8(9-4-2-3-5-9)16-10-17-11(20-13)19-12(18-10)21-7-14-6-15-21/h6-9H,2-5,13H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | AQJVITYEKVUOSY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|