C14H25N7 — CID 80906721
2-N-(2-bicyclo[2.2.1]heptanylmethyl)-6-hydrazinyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80906721) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-N-(2-bicyclo[2.2.1]heptanylmethyl)-6-hydrazinyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-bicyclo[2.2.1]heptanylmethyl)-6-hydrazinyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80906721 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-N-(2-bicyclo[2.2.1]heptanylmethyl)-6-hydrazinyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NN)nc(N(C)CC2CC3CCC2C3)n1 |
| InChI | InChI=1S/C14H25N7/c1-20(2)13-16-12(19-15)17-14(18-13)21(3)8-11-7-9-4-5-10(11)6-9/h9-11H,4-8,15H2,1-3H3,(H,16,17,18,19) |
| InChIKey | ZBJUCQFKNWJBBW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|