C11H18FN5O — CID 80908306
[5-fluoro-4-(2,2,6-trimethylmorpholin-4-yl)pyrimidin-2-yl]hydrazine (PubChem CID 80908306) has the molecular formula C11H18FN5O and a molecular weight of 255.30 g/mol. Its IUPAC name is [5-fluoro-4-(2,2,6-trimethylmorpholin-4-yl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-(2,2,6-trimethylmorpholin-4-yl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80908306 |
| Molecular Formula | C11H18FN5O |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [5-fluoro-4-(2,2,6-trimethylmorpholin-4-yl)pyrimidin-2-yl]hydrazine |
| SMILES | CC1CN(c2nc(NN)ncc2F)CC(C)(C)O1 |
| InChI | InChI=1S/C11H18FN5O/c1-7-5-17(6-11(2,3)18-7)9-8(12)4-14-10(15-9)16-13/h4,7H,5-6,13H2,1-3H3,(H,14,15,16) |
| InChIKey | SXXSUDNLELEZLG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|