C8H12F3N5O — CID 80908998
6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 80908998) has the molecular formula C8H12F3N5O and a molecular weight of 251.21 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80908998 |
| Molecular Formula | C8H12F3N5O |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | NNc1cc(NCCOCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C8H12F3N5O/c9-8(10,11)4-17-2-1-13-6-3-7(16-12)15-5-14-6/h3,5H,1-2,4,12H2,(H2,13,14,15,16) |
| InChIKey | SMZYAARJTWDGPI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|