About [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine
[4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine (PubChem CID 80909907) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine |
| PubChem CID | 80909907 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine |
| SMILES | Cc1ccc(Oc2nc(NN)nc3ccccc23)cc1C |
| InChI | InChI=1S/C16H16N4O/c1-10-7-8-12(9-11(10)2)21-15-13-5-3-4-6-14(13)18-16(19-15)20-17/h3-9H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | SPXHWTWHNGCWAX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine?
The IUPAC name of [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine (CID 80909907) is [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine.
What is the SMILES notation for [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine?
The canonical SMILES for [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine is Cc1ccc(Oc2nc(NN)nc3ccccc23)cc1C.
What is the InChIKey of [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine?
The InChIKey is SPXHWTWHNGCWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O/c1-10-7-8-12(9-11(10)2)21-15-13-5-3-4-6-14(13)18-16(19-15)20-17/h3-9H,17H2,1-2H3,(H,18,19,20).
What are the key properties of [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine?
[4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine has a molecular weight of 280.33 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dimethylphenoxy)quinazolin-2-yl]hydrazine is sourced from PubChem (CID 80909907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).