C8H13F3N6O — CID 80910269
6-hydrazinyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine (PubChem CID 80910269) has the molecular formula C8H13F3N6O and a molecular weight of 266.23 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80910269 |
| Molecular Formula | C8H13F3N6O |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-hydrazinyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine |
| SMILES | NNc1cc(NCCOCC(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C8H13F3N6O/c9-8(10,11)4-18-2-1-14-5-3-6(17-13)16-7(12)15-5/h3H,1-2,4,13H2,(H4,12,14,15,16,17) |
| InChIKey | ASOVNVXLSGRZLL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|