C11H12N6O4 — CID 80912368
[4-methoxy-6-(5-methyl-2-nitrophenoxy)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80912368) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is [4-methoxy-6-(5-methyl-2-nitrophenoxy)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-methoxy-6-(5-methyl-2-nitrophenoxy)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80912368 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [4-methoxy-6-(5-methyl-2-nitrophenoxy)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(Oc2cc(C)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H12N6O4/c1-6-3-4-7(17(18)19)8(5-6)21-11-14-9(16-12)13-10(15-11)20-2/h3-5H,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | ZGCOIVDTTSGRJK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|