C12H18N4O2S — CID 80912767
[3-(2,6-dimethylthiomorpholin-4-yl)-5-nitrophenyl]hydrazine (PubChem CID 80912767) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is [3-(2,6-dimethylthiomorpholin-4-yl)-5-nitrophenyl]hydrazine.
| Compound Name | [3-(2,6-dimethylthiomorpholin-4-yl)-5-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 80912767 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [3-(2,6-dimethylthiomorpholin-4-yl)-5-nitrophenyl]hydrazine |
| SMILES | CC1CN(c2cc(NN)cc([N+](=O)[O-])c2)CC(C)S1 |
| InChI | InChI=1S/C12H18N4O2S/c1-8-6-15(7-9(2)19-8)11-3-10(14-13)4-12(5-11)16(17)18/h3-5,8-9,14H,6-7,13H2,1-2H3 |
| InChIKey | GFYZUCZBOHWVIS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|