C16H17BrN4 — CID 809140
6-bromo-N-tert-butyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 809140) has the molecular formula C16H17BrN4 and a molecular weight of 345.24 g/mol. Its IUPAC name is 6-bromo-N-tert-butyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 6-bromo-N-tert-butyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 809140 |
| Molecular Formula | C16H17BrN4 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 6-bromo-N-tert-butyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CC(C)(C)Nc1c(-c2ccccn2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C16H17BrN4/c1-16(2,3)20-15-14(12-6-4-5-9-18-12)19-13-8-7-11(17)10-21(13)15/h4-10,20H,1-3H3 |
| InChIKey | HICWQLMTCDKIEQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'} |
|---|