About N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine
N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine (PubChem CID 80914834) has the molecular formula C12H21FN6
and a molecular weight of 268.34 g/mol. Its IUPAC name is N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 80914834 |
| Molecular Formula | C12H21FN6 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNc1nc(NN)ncc1F)C1CCCC1 |
| InChI | InChI=1S/C12H21FN6/c1-19(9-4-2-3-5-9)7-6-15-11-10(13)8-16-12(17-11)18-14/h8-9H,2-7,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | ZYPDNUXBJFBPOX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine (CID 80914834) is N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine is CN(CCNc1nc(NN)ncc1F)C1CCCC1.
What is the InChIKey of N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The InChIKey is ZYPDNUXBJFBPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21FN6/c1-19(9-4-2-3-5-9)7-6-15-11-10(13)8-16-12(17-11)18-14/h8-9H,2-7,14H2,1H3,(H2,15,16,17,18).
What are the key properties of N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine?
N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine has a molecular weight of 268.34 g/mol, XLogP of 1.19, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 80914834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).